About [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone
[5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone (PubChem CID 57129859) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone.
Molecular Properties
| Compound Name | [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone |
| PubChem CID | 57129859 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone |
| SMILES | O=C=C1OCC=CC1OCc1ccco1 |
| InChI | InChI=1S/C11H10O4/c12-7-11-10(4-2-6-14-11)15-8-9-3-1-5-13-9/h1-5,10H,6,8H2 |
| InChIKey | PXGWOQUEESHXKM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone?
The IUPAC name of [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone (CID 57129859) is [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone.
What is the SMILES notation for [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone?
The canonical SMILES for [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone is O=C=C1OCC=CC1OCc1ccco1.
What is the InChIKey of [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone?
The InChIKey is PXGWOQUEESHXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c12-7-11-10(4-2-6-14-11)15-8-9-3-1-5-13-9/h1-5,10H,6,8H2.
What are the key properties of [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone?
[5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone has a molecular weight of 206.20 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(furan-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone is sourced from PubChem (CID 57129859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).