About tris(furan-2-ylmethoxy) phosphite
tris(furan-2-ylmethoxy) phosphite (PubChem CID 88505221) has the molecular formula C15H15O9P
and a molecular weight of 370.25 g/mol. Its IUPAC name is tris(furan-2-ylmethoxy) phosphite.
Molecular Properties
| Compound Name | tris(furan-2-ylmethoxy) phosphite |
| PubChem CID | 88505221 |
| Molecular Formula | C15H15O9P |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | tris(furan-2-ylmethoxy) phosphite |
| SMILES | c1coc(COOP(OOCc2ccco2)OOCc2ccco2)c1 |
| InChI | InChI=1S/C15H15O9P/c1-4-13(16-7-1)10-19-22-25(23-20-11-14-5-2-8-17-14)24-21-12-15-6-3-9-18-15/h1-9H,10-12H2 |
| InChIKey | OQKVKYMMSIKQDT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(furan-2-ylmethoxy) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(furan-2-ylmethoxy) phosphite?
The IUPAC name of tris(furan-2-ylmethoxy) phosphite (CID 88505221) is tris(furan-2-ylmethoxy) phosphite.
What is the SMILES notation for tris(furan-2-ylmethoxy) phosphite?
The canonical SMILES for tris(furan-2-ylmethoxy) phosphite is c1coc(COOP(OOCc2ccco2)OOCc2ccco2)c1.
What is the InChIKey of tris(furan-2-ylmethoxy) phosphite?
The InChIKey is OQKVKYMMSIKQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15O9P/c1-4-13(16-7-1)10-19-22-25(23-20-11-14-5-2-8-17-14)24-21-12-15-6-3-9-18-15/h1-9H,10-12H2.
What are the key properties of tris(furan-2-ylmethoxy) phosphite?
tris(furan-2-ylmethoxy) phosphite has a molecular weight of 370.25 g/mol, XLogP of 4.44, 12 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tris(furan-2-ylmethoxy) phosphite is sourced from PubChem (CID 88505221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).