C22H25ClO4 — CID 54314408
(2-chloro-3-methylpentyl) 4-(4-propanoyloxyphenyl)benzoate (PubChem CID 54314408) has the molecular formula C22H25ClO4 and a molecular weight of 388.89 g/mol. Its IUPAC name is (2-chloro-3-methylpentyl) 4-(4-propanoyloxyphenyl)benzoate.
| Compound Name | (2-chloro-3-methylpentyl) 4-(4-propanoyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 54314408 |
| Molecular Formula | C22H25ClO4 |
| Molecular Weight | 388.89 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2-chloro-3-methylpentyl) 4-(4-propanoyloxyphenyl)benzoate |
| SMILES | CCC(=O)Oc1ccc(-c2ccc(C(=O)OCC(Cl)C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C22H25ClO4/c1-4-15(3)20(23)14-26-22(25)18-8-6-16(7-9-18)17-10-12-19(13-11-17)27-21(24)5-2/h6-13,15,20H,4-5,14H2,1-3H3 |
| InChIKey | SNDKVLKTGIYZFK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|