C28H36O4 — CID 14548846
[(2S)-2-methylbutyl] 4-[4-(3-pentylcyclobutanecarbonyl)oxyphenyl]benzoate (PubChem CID 14548846) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 4-[4-(3-pentylcyclobutanecarbonyl)oxyphenyl]benzoate.
| Compound Name | [(2S)-2-methylbutyl] 4-[4-(3-pentylcyclobutanecarbonyl)oxyphenyl]benzoate |
|---|---|
| PubChem CID | 14548846 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(2S)-2-methylbutyl] 4-[4-(3-pentylcyclobutanecarbonyl)oxyphenyl]benzoate |
| SMILES | CCCCCC1CC(C(=O)Oc2ccc(-c3ccc(C(=O)OC[C@@H](C)CC)cc3)cc2)C1 |
| InChI | InChI=1S/C28H36O4/c1-4-6-7-8-21-17-25(18-21)28(30)32-26-15-13-23(14-16-26)22-9-11-24(12-10-22)27(29)31-19-20(3)5-2/h9-16,20-21,25H,4-8,17-19H2,1-3H3/t20-,21?,25?/m0/s1 |
| InChIKey | MJYPJFPSFYZYQG-LQAIBEDLSA-N |
| XLogP | 7.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|