C35H42O5 — CID 14548862
[4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-[4-[(3-pentylcyclobutyl)methoxy]phenyl]benzoate (PubChem CID 14548862) has the molecular formula C35H42O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is [4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-[4-[(3-pentylcyclobutyl)methoxy]phenyl]benzoate.
| Compound Name | [4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-[4-[(3-pentylcyclobutyl)methoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 14548862 |
| Molecular Formula | C35H42O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | [4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-[4-[(3-pentylcyclobutyl)methoxy]phenyl]benzoate |
| SMILES | CCCCCC1CC(COc2ccc(-c3ccc(C(=O)Oc4ccc(C(=O)OC[C@@H](C)CC)cc4)cc3)cc2)C1 |
| InChI | InChI=1S/C35H42O5/c1-4-6-7-8-26-21-27(22-26)24-38-32-17-13-29(14-18-32)28-9-11-31(12-10-28)35(37)40-33-19-15-30(16-20-33)34(36)39-23-25(3)5-2/h9-20,25-27H,4-8,21-24H2,1-3H3/t25-,26?,27?/m0/s1 |
| InChIKey | XGTAVAPESUADHB-JRFCFUNGSA-N |
| XLogP | 8.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|