C32H46O3 — CID 54007754
[4-[(2S)-2-methylbutyl]phenyl] 4-[(4-heptylcyclohexyl)methoxy]benzoate (PubChem CID 54007754) has the molecular formula C32H46O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is [4-[(2S)-2-methylbutyl]phenyl] 4-[(4-heptylcyclohexyl)methoxy]benzoate.
| Compound Name | [4-[(2S)-2-methylbutyl]phenyl] 4-[(4-heptylcyclohexyl)methoxy]benzoate |
|---|---|
| PubChem CID | 54007754 |
| Molecular Formula | C32H46O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | [4-[(2S)-2-methylbutyl]phenyl] 4-[(4-heptylcyclohexyl)methoxy]benzoate |
| SMILES | CCCCCCCC1CCC(COc2ccc(C(=O)Oc3ccc(C[C@@H](C)CC)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H46O3/c1-4-6-7-8-9-10-26-11-13-28(14-12-26)24-34-30-21-17-29(18-22-30)32(33)35-31-19-15-27(16-20-31)23-25(3)5-2/h15-22,25-26,28H,4-14,23-24H2,1-3H3/t25-,26?,28?/m0/s1 |
| InChIKey | KQCBEWMIKWMEDH-MRNPYCGKSA-N |
| XLogP | 9.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|