C28H30O7 — CID 173316115
[4-[4-(4-hydroxycyclohexyl)oxycarbonylcyclohexanecarbonyl]phenyl] 4-formylbenzoate (PubChem CID 173316115) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is [4-[4-(4-hydroxycyclohexyl)oxycarbonylcyclohexanecarbonyl]phenyl] 4-formylbenzoate.
| Compound Name | [4-[4-(4-hydroxycyclohexyl)oxycarbonylcyclohexanecarbonyl]phenyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 173316115 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [4-[4-(4-hydroxycyclohexyl)oxycarbonylcyclohexanecarbonyl]phenyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)Oc2ccc(C(=O)C3CCC(C(=O)OC4CCC(O)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H30O7/c29-17-18-1-3-21(4-2-18)27(32)34-24-13-9-20(10-14-24)26(31)19-5-7-22(8-6-19)28(33)35-25-15-11-23(30)12-16-25/h1-4,9-10,13-14,17,19,22-23,25,30H,5-8,11-12,15-16H2 |
| InChIKey | COZAPLUFIVYAOE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|