C24H25F3N2O4 — CID 90698672
[4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 90698672) has the molecular formula C24H25F3N2O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is [4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90698672 |
| Molecular Formula | C24H25F3N2O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [4-[3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate |
| SMILES | Nc1cc(N)cc(COC(=O)C=Cc2ccc(OC(=O)C3CCC(C(F)(F)F)CC3)cc2)c1 |
| InChI | InChI=1S/C24H25F3N2O4/c25-24(26,27)18-6-4-17(5-7-18)23(31)33-21-8-1-15(2-9-21)3-10-22(30)32-14-16-11-19(28)13-20(29)12-16/h1-3,8-13,17-18H,4-7,14,28-29H2 |
| InChIKey | WQQIQEDIOARWQJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|