C31H30F6N2O5 — CID 155613100
N'-(4-methoxyphenyl)-N'-[1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propanediamide (PubChem CID 155613100) has the molecular formula C31H30F6N2O5 and a molecular weight of 624.58 g/mol. Its IUPAC name is N'-(4-methoxyphenyl)-N'-[1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propanediamide.
| Compound Name | N'-(4-methoxyphenyl)-N'-[1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propanediamide |
|---|---|
| PubChem CID | 155613100 |
| Molecular Formula | C31H30F6N2O5 |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | N'-(4-methoxyphenyl)-N'-[1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propanediamide |
| SMILES | COc1ccc(N(C(=O)CC(N)=O)C(CC(=O)c2ccc(C)cc2)(c2ccc(OCCCC(F)(F)F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H30F6N2O5/c1-20-4-6-21(7-5-20)26(40)19-29(31(35,36)37,22-8-12-25(13-9-22)44-17-3-16-30(32,33)34)39(28(42)18-27(38)41)23-10-14-24(43-2)15-11-23/h4-15H,3,16-19H2,1-2H3,(H2,38,41) |
| InChIKey | YEEXHSFYADTPDH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|