C18H18F6N2O4 — CID 118362594
methyl (3S)-3-[(2-cyanoacetyl)amino]-4,4,4-trifluoro-3-[4-(4,4,4-trifluorobutoxy)phenyl]butanoate (PubChem CID 118362594) has the molecular formula C18H18F6N2O4 and a molecular weight of 440.34 g/mol. Its IUPAC name is methyl (3S)-3-[(2-cyanoacetyl)amino]-4,4,4-trifluoro-3-[4-(4,4,4-trifluorobutoxy)phenyl]butanoate.
| Compound Name | methyl (3S)-3-[(2-cyanoacetyl)amino]-4,4,4-trifluoro-3-[4-(4,4,4-trifluorobutoxy)phenyl]butanoate |
|---|---|
| PubChem CID | 118362594 |
| Molecular Formula | C18H18F6N2O4 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | methyl (3S)-3-[(2-cyanoacetyl)amino]-4,4,4-trifluoro-3-[4-(4,4,4-trifluorobutoxy)phenyl]butanoate |
| SMILES | COC(=O)C[C@](NC(=O)CC#N)(c1ccc(OCCCC(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H18F6N2O4/c1-29-15(28)11-16(18(22,23)24,26-14(27)7-9-25)12-3-5-13(6-4-12)30-10-2-8-17(19,20)21/h3-6H,2,7-8,10-11H2,1H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | OJRYWKJJWVSDJT-INIZCTEOSA-N |
| XLogP | 3.76 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|