C14H18F3NO3 — CID 142257655
2-[4-(4,4,4-trifluorobutoxy)anilino]ethyl acetate (PubChem CID 142257655) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[4-(4,4,4-trifluorobutoxy)anilino]ethyl acetate.
| Compound Name | 2-[4-(4,4,4-trifluorobutoxy)anilino]ethyl acetate |
|---|---|
| PubChem CID | 142257655 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[4-(4,4,4-trifluorobutoxy)anilino]ethyl acetate |
| SMILES | CC(=O)OCCNc1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO3/c1-11(19)20-10-8-18-12-3-5-13(6-4-12)21-9-2-7-14(15,16)17/h3-6,18H,2,7-10H2,1H3 |
| InChIKey | COIACQYYXIYZCK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|