C32H54F4N2O3 — CID 160585625
N-decyl-4-(10,10,10-trifluorodecoxy)aniline;4-fluoropiperidine-4-carboxylic acid (PubChem CID 160585625) has the molecular formula C32H54F4N2O3 and a molecular weight of 590.79 g/mol. Its IUPAC name is N-decyl-4-(10,10,10-trifluorodecoxy)aniline;4-fluoropiperidine-4-carboxylic acid.
| Compound Name | N-decyl-4-(10,10,10-trifluorodecoxy)aniline;4-fluoropiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 160585625 |
| Molecular Formula | C32H54F4N2O3 |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 590.41 |
| IUPAC Name | N-decyl-4-(10,10,10-trifluorodecoxy)aniline;4-fluoropiperidine-4-carboxylic acid |
| SMILES | CCCCCCCCCCNc1ccc(OCCCCCCCCCC(F)(F)F)cc1.O=C(O)C1(F)CCNCC1 |
| InChI | InChI=1S/C26H44F3NO.C6H10FNO2/c1-2-3-4-5-6-9-12-15-22-30-24-17-19-25(20-18-24)31-23-16-13-10-7-8-11-14-21-26(27,28)29;7-6(5(9)10)1-3-8-4-2-6/h17-20,30H,2-16,21-23H2,1H3;8H,1-4H2,(H,9,10) |
| InChIKey | RCIUWWCKIJJFDA-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|