C16H21F3O3 — CID 145345570
2-methylbutan-2-yl 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 145345570) has the molecular formula C16H21F3O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | 2-methylbutan-2-yl 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 145345570 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-methylbutan-2-yl 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | CCC(C)(C)OC(=O)c1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3O3/c1-4-15(2,3)22-14(20)12-6-8-13(9-7-12)21-11-5-10-16(17,18)19/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | DEDAZFHQMHIOEH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|