C12H15F3N3O4+ — CID 7353017
methyl (2S)-2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-(pyridin-1-ium-2-ylamino)propanoate (PubChem CID 7353017) has the molecular formula C12H15F3N3O4+ and a molecular weight of 322.26 g/mol. Its IUPAC name is methyl (2S)-2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-(pyridin-1-ium-2-ylamino)propanoate.
| Compound Name | methyl (2S)-2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-(pyridin-1-ium-2-ylamino)propanoate |
|---|---|
| PubChem CID | 7353017 |
| Molecular Formula | C12H15F3N3O4+ |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | methyl (2S)-2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-(pyridin-1-ium-2-ylamino)propanoate |
| SMILES | CCOC(=O)N[C@@](Nc1cccc[nH+]1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O4/c1-3-22-10(20)18-11(9(19)21-2,12(13,14)15)17-8-6-4-5-7-16-8/h4-7H,3H2,1-2H3,(H,16,17)(H,18,20)/p+1/t11-/m0/s1 |
| InChIKey | XWSBGMJLCRZUCN-NSHDSACASA-O |
| XLogP | 1.09 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|