C11H10Cl2F3N3O3 — CID 540804
methyl 2-acetamido-2-[(3,5-dichloro-2-pyridinyl)amino]-3,3,3-trifluoropropanoate (PubChem CID 540804) has the molecular formula C11H10Cl2F3N3O3 and a molecular weight of 360.12 g/mol. Its IUPAC name is methyl 2-acetamido-2-[(3,5-dichloro-2-pyridinyl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-acetamido-2-[(3,5-dichloro-2-pyridinyl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 540804 |
| Molecular Formula | C11H10Cl2F3N3O3 |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | methyl 2-acetamido-2-[(3,5-dichloro-2-pyridinyl)amino]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(NC(C)=O)(Nc1ncc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H10Cl2F3N3O3/c1-5(20)18-10(9(21)22-2,11(14,15)16)19-8-7(13)3-6(12)4-17-8/h3-4H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | DRTXHSCJAAPIRC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|