C18H13Cl2F3N2O3 — CID 3471390
[1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 3471390) has the molecular formula C18H13Cl2F3N2O3 and a molecular weight of 433.21 g/mol. Its IUPAC name is [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3471390 |
| Molecular Formula | C18H13Cl2F3N2O3 |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1cccc(C(F)(F)F)c1)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2F3N2O3/c1-10(17(27)25-16-14(20)8-13(19)9-24-16)28-15(26)6-5-11-3-2-4-12(7-11)18(21,22)23/h2-10H,1H3,(H,24,25,27) |
| InChIKey | BHFQMCAQHMLJIK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|