About methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate
methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate (PubChem CID 24828891) has the molecular formula C9H6ClF4NO2
and a molecular weight of 271.60 g/mol. Its IUPAC name is methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate.
Analyze methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate?
The IUPAC name of methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate (CID 24828891) is methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate.
What is the SMILES notation for methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate?
The canonical SMILES for methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate is COC(=O)C(F)(c1cc(Cl)ccn1)C(F)(F)F.
What is the InChIKey of methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate?
The InChIKey is DHRVCADQXUPBBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClF4NO2/c1-17-7(16)8(11,9(12,13)14)6-4-5(10)2-3-15-6/h2-4H,1H3.
What are the key properties of methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate?
methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate has a molecular weight of 271.60 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-chloro-2-pyridinyl)-2,3,3,3-tetrafluoropropanoate is sourced from PubChem (CID 24828891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).