C11H11ClF3NO2 — CID 106523315
methyl 2-(3-chloroanilino)-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 106523315) has the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. Its IUPAC name is methyl 2-(3-chloroanilino)-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | methyl 2-(3-chloroanilino)-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 106523315 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | methyl 2-(3-chloroanilino)-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | COC(=O)C(C)(Nc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2/c1-10(9(17)18-2,11(13,14)15)16-8-5-3-4-7(12)6-8/h3-6,16H,1-2H3 |
| InChIKey | DWSZKWPPMPHVEU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |