C14H10ClF3N2O2 — CID 45141626
methyl 4-chloro-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (PubChem CID 45141626) has the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. Its IUPAC name is methyl 4-chloro-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-chloro-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 45141626 |
| Molecular Formula | C14H10ClF3N2O2 |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | methyl 4-chloro-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1Nc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10ClF3N2O2/c1-22-13(21)10-3-2-8(15)6-11(10)20-9-4-5-19-12(7-9)14(16,17)18/h2-7H,1H3,(H,19,20) |
| InChIKey | VMHVWKVUIPGGSS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |