C20H15F3N2O2S — CID 11596558
(4-methylsulfanylphenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (PubChem CID 11596558) has the molecular formula C20H15F3N2O2S and a molecular weight of 404.41 g/mol. Its IUPAC name is (4-methylsulfanylphenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
| Compound Name | (4-methylsulfanylphenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 11596558 |
| Molecular Formula | C20H15F3N2O2S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (4-methylsulfanylphenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| SMILES | CSc1ccc(OC(=O)c2ccccc2Nc2ccnc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H15F3N2O2S/c1-28-15-8-6-14(7-9-15)27-19(26)16-4-2-3-5-17(16)25-13-10-11-24-18(12-13)20(21,22)23/h2-12H,1H3,(H,24,25) |
| InChIKey | MEAYQBDQPODNHW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|