C24H24F3N5O2 — CID 135968272
N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzamide (PubChem CID 135968272) has the molecular formula C24H24F3N5O2 and a molecular weight of 471.48 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzamide.
| Compound Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzamide |
|---|---|
| PubChem CID | 135968272 |
| Molecular Formula | C24H24F3N5O2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)c2ccccc2Nc2ccnc(C(F)(F)F)c2)c(O)c1 |
| InChI | InChI=1S/C24H24F3N5O2/c1-3-32(4-2)18-10-9-16(21(33)14-18)15-29-31-23(34)19-7-5-6-8-20(19)30-17-11-12-28-22(13-17)24(25,26)27/h5-15,33H,3-4H2,1-2H3,(H,28,30)(H,31,34)/b29-15+ |
| InChIKey | ZQDTXQOYYYIOBK-WKULSOCRSA-N |
| XLogP | 5.16 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|