C18H28ClNO4 — CID 170547895
2-tert-butyl-6-(4-chloro-2-pyridinyl)-6,6-dimethoxy-2-methylhexanoic acid (PubChem CID 170547895) has the molecular formula C18H28ClNO4 and a molecular weight of 357.88 g/mol. Its IUPAC name is 2-tert-butyl-6-(4-chloro-2-pyridinyl)-6,6-dimethoxy-2-methylhexanoic acid.
| Compound Name | 2-tert-butyl-6-(4-chloro-2-pyridinyl)-6,6-dimethoxy-2-methylhexanoic acid |
|---|---|
| PubChem CID | 170547895 |
| Molecular Formula | C18H28ClNO4 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-tert-butyl-6-(4-chloro-2-pyridinyl)-6,6-dimethoxy-2-methylhexanoic acid |
| SMILES | COC(CCCC(C)(C(=O)O)C(C)(C)C)(OC)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C18H28ClNO4/c1-16(2,3)17(4,15(21)22)9-7-10-18(23-5,24-6)14-12-13(19)8-11-20-14/h8,11-12H,7,9-10H2,1-6H3,(H,21,22) |
| InChIKey | NKJFCARMXGCTCA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|