C11H14ClNO — CID 144559566
1-(4-chloro-2-pyridinyl)-3,3-dimethylbutan-2-one (PubChem CID 144559566) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 1-(4-chloro-2-pyridinyl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(4-chloro-2-pyridinyl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 144559566 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(4-chloro-2-pyridinyl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)Cc1cc(Cl)ccn1 |
| InChI | InChI=1S/C11H14ClNO/c1-11(2,3)10(14)7-9-6-8(12)4-5-13-9/h4-6H,7H2,1-3H3 |
| InChIKey | PARZPCIATQOVDH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |