C18H17ClF3N3O3S — CID 5092630
methyl 2-[(2-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate (PubChem CID 5092630) has the molecular formula C18H17ClF3N3O3S and a molecular weight of 447.87 g/mol. Its IUPAC name is methyl 2-[(2-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate.
| Compound Name | methyl 2-[(2-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 5092630 |
| Molecular Formula | C18H17ClF3N3O3S |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | methyl 2-[(2-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1Cl)(Nc1nc2c(s1)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C18H17ClF3N3O3S/c1-28-15(27)17(18(20,21)22,24-14(26)10-6-2-3-7-11(10)19)25-16-23-12-8-4-5-9-13(12)29-16/h2-3,6-7H,4-5,8-9H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | HBTACSFDLYDDGM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|