C12H13F6N3OS — CID 4271203
N-[1,1,1,3,3,3-hexafluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propan-2-yl]acetamide (PubChem CID 4271203) has the molecular formula C12H13F6N3OS and a molecular weight of 361.31 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propan-2-yl]acetamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 4271203 |
| Molecular Formula | C12H13F6N3OS |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propan-2-yl]acetamide |
| SMILES | CC(=O)NC(Nc1nc2c(s1)CCCC2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H13F6N3OS/c1-6(22)20-10(11(13,14)15,12(16,17)18)21-9-19-7-4-2-3-5-8(7)23-9/h2-5H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | RZVFAFMCEYBBHK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|