C10H10F4N2OS — CID 113250817
2,2,3,3-tetrafluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 113250817) has the molecular formula C10H10F4N2OS and a molecular weight of 282.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 113250817 |
| Molecular Formula | C10H10F4N2OS |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nc2c(s1)CCCC2)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H10F4N2OS/c11-7(12)10(13,14)8(17)16-9-15-5-3-1-2-4-6(5)18-9/h7H,1-4H2,(H,15,16,17) |
| InChIKey | ZVMHEYQLNBXGNN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|