C12H18N2OS2 — CID 107025752
3-methyl-2-sulfanyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide (PubChem CID 107025752) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-methyl-2-sulfanyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 3-methyl-2-sulfanyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 107025752 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-methyl-2-sulfanyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CC(C)C(S)C(=O)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C12H18N2OS2/c1-7(2)10(16)11(15)14-12-13-8-5-3-4-6-9(8)17-12/h7,10,16H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | MSTQNKOHLCENRY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|