C15H25N3OS — CID 119743841
(2S)-2-amino-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-methylpentanamide (PubChem CID 119743841) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is (2S)-2-amino-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 119743841 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (2S)-2-amino-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1nc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C15H25N3OS/c1-10(2)9-11(16)14(19)18-15-17-12-7-5-3-4-6-8-13(12)20-15/h10-11H,3-9,16H2,1-2H3,(H,17,18,19)/t11-/m0/s1 |
| InChIKey | BHSIYYBPUKPROA-NSHDSACASA-N |
| XLogP | 3.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |