C15H17F3N4O3S — CID 3751892
ethyl 2-(1,3-benzothiazol-2-ylamino)-2-(dimethylcarbamoylamino)-3,3,3-trifluoropropanoate (PubChem CID 3751892) has the molecular formula C15H17F3N4O3S and a molecular weight of 390.39 g/mol. Its IUPAC name is ethyl 2-(1,3-benzothiazol-2-ylamino)-2-(dimethylcarbamoylamino)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-(1,3-benzothiazol-2-ylamino)-2-(dimethylcarbamoylamino)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 3751892 |
| Molecular Formula | C15H17F3N4O3S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | ethyl 2-(1,3-benzothiazol-2-ylamino)-2-(dimethylcarbamoylamino)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(NC(=O)N(C)C)(Nc1nc2ccccc2s1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N4O3S/c1-4-25-11(23)14(15(16,17)18,21-13(24)22(2)3)20-12-19-9-7-5-6-8-10(9)26-12/h5-8H,4H2,1-3H3,(H,19,20)(H,21,24) |
| InChIKey | NKIOLFUPJBJTGM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|