C13H20N2S — CID 157105322
N-tert-butyl-1,3-benzothiazol-2-amine;ethane (PubChem CID 157105322) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-tert-butyl-1,3-benzothiazol-2-amine;ethane.
| Compound Name | N-tert-butyl-1,3-benzothiazol-2-amine;ethane |
|---|---|
| PubChem CID | 157105322 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-tert-butyl-1,3-benzothiazol-2-amine;ethane |
| SMILES | CC.CC(C)(C)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H14N2S.C2H6/c1-11(2,3)13-10-12-8-6-4-5-7-9(8)14-10;1-2/h4-7H,1-3H3,(H,12,13);1-2H3 |
| InChIKey | AGFOTVPAKSQXDB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |