C14H21N3S — CID 114149292
N-(1,3-benzothiazol-2-yl)-2,2-dimethylpentane-1,5-diamine (PubChem CID 114149292) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2,2-dimethylpentane-1,5-diamine.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2,2-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 114149292 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2,2-dimethylpentane-1,5-diamine |
| SMILES | CC(C)(CCCN)CNc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H21N3S/c1-14(2,8-5-9-15)10-16-13-17-11-6-3-4-7-12(11)18-13/h3-4,6-7H,5,8-10,15H2,1-2H3,(H,16,17) |
| InChIKey | XVSRWOQMQLFDNB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |