C14H21N3OS — CID 106141110
5-[(6-amino-1,3-benzothiazol-2-yl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 106141110) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 5-[(6-amino-1,3-benzothiazol-2-yl)amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(6-amino-1,3-benzothiazol-2-yl)amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106141110 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-[(6-amino-1,3-benzothiazol-2-yl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C14H21N3OS/c1-14(2,6-3-7-18)9-16-13-17-11-5-4-10(15)8-12(11)19-13/h4-5,8,18H,3,6-7,9,15H2,1-2H3,(H,16,17) |
| InChIKey | JDRXNDWOARXZCH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|