C12H16N4OS — CID 114142761
3-[(6-amino-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide (PubChem CID 114142761) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide.
| Compound Name | 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 114142761 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C12H16N4OS/c1-12(2,6-10(14)17)16-11-15-8-4-3-7(13)5-9(8)18-11/h3-5H,6,13H2,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | BDPAHWCLUOPZRN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|