C15H15F4N3O4S — CID 3363728
ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]propanoate (PubChem CID 3363728) has the molecular formula C15H15F4N3O4S and a molecular weight of 409.36 g/mol. Its IUPAC name is ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]propanoate.
| Compound Name | ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 3363728 |
| Molecular Formula | C15H15F4N3O4S |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]propanoate |
| SMILES | CCOC(=O)NC(Nc1nc2ccc(F)cc2s1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C15H15F4N3O4S/c1-3-25-11(23)14(15(17,18)19,22-13(24)26-4-2)21-12-20-9-6-5-8(16)7-10(9)27-12/h5-7H,3-4H2,1-2H3,(H,20,21)(H,22,24) |
| InChIKey | MEFSIWCEXXFDDU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|