C21H28F3N3O4S — CID 26501754
ethyl (2S)-2-[(6-butoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(pentanoylamino)propanoate (PubChem CID 26501754) has the molecular formula C21H28F3N3O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is ethyl (2S)-2-[(6-butoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(pentanoylamino)propanoate.
| Compound Name | ethyl (2S)-2-[(6-butoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(pentanoylamino)propanoate |
|---|---|
| PubChem CID | 26501754 |
| Molecular Formula | C21H28F3N3O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | ethyl (2S)-2-[(6-butoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(pentanoylamino)propanoate |
| SMILES | CCCCOc1ccc2nc(N[C@@](NC(=O)CCCC)(C(=O)OCC)C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C21H28F3N3O4S/c1-4-7-9-17(28)26-20(21(22,23)24,18(29)30-6-3)27-19-25-15-11-10-14(13-16(15)32-19)31-12-8-5-2/h10-11,13H,4-9,12H2,1-3H3,(H,25,27)(H,26,28)/t20-/m0/s1 |
| InChIKey | HAVGMSGQNGLWNJ-FQEVSTJZSA-N |
| XLogP | 5.02 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|