C21H24N2O3S — CID 19218142
N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(2,4-dimethylphenoxy)acetamide (PubChem CID 19218142) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(2,4-dimethylphenoxy)acetamide.
| Compound Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(2,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 19218142 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(2,4-dimethylphenoxy)acetamide |
| SMILES | CCCCOc1ccc2nc(NC(=O)COc3ccc(C)cc3C)sc2c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-4-5-10-25-16-7-8-17-19(12-16)27-21(22-17)23-20(24)13-26-18-9-6-14(2)11-15(18)3/h6-9,11-12H,4-5,10,13H2,1-3H3,(H,22,23,24) |
| InChIKey | LIQONFZEYFAECC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|