C22H22N2O2 — CID 58392913
tert-butyl (3R)-3-cyano-4-[4-(3-cyanophenyl)phenyl]butanoate (PubChem CID 58392913) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl (3R)-3-cyano-4-[4-(3-cyanophenyl)phenyl]butanoate.
| Compound Name | tert-butyl (3R)-3-cyano-4-[4-(3-cyanophenyl)phenyl]butanoate |
|---|---|
| PubChem CID | 58392913 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | tert-butyl (3R)-3-cyano-4-[4-(3-cyanophenyl)phenyl]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](C#N)Cc1ccc(-c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-22(2,3)26-21(25)13-18(15-24)11-16-7-9-19(10-8-16)20-6-4-5-17(12-20)14-23/h4-10,12,18H,11,13H2,1-3H3/t18-/m1/s1 |
| InChIKey | IBYIOANUDVYEQQ-GOSISDBHSA-N |
| XLogP | 4.64 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |