C14H17N3O2S — CID 19855133
tert-butyl 2-[(3-cyanophenyl)carbamothioylamino]acetate (PubChem CID 19855133) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is tert-butyl 2-[(3-cyanophenyl)carbamothioylamino]acetate.
| Compound Name | tert-butyl 2-[(3-cyanophenyl)carbamothioylamino]acetate |
|---|---|
| PubChem CID | 19855133 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | tert-butyl 2-[(3-cyanophenyl)carbamothioylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=S)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H17N3O2S/c1-14(2,3)19-12(18)9-16-13(20)17-11-6-4-5-10(7-11)8-15/h4-7H,9H2,1-3H3,(H2,16,17,20) |
| InChIKey | YYBQAUJAPZHZJI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|