C15H17N3O4S — CID 17338801
2-methoxyethyl 4-[(3-cyanophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 17338801) has the molecular formula C15H17N3O4S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(3-cyanophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[(3-cyanophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17338801 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-methoxyethyl 4-[(3-cyanophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H17N3O4S/c1-21-7-8-22-14(20)6-5-13(19)18-15(23)17-12-4-2-3-11(9-12)10-16/h2-4,9H,5-8H2,1H3,(H2,17,18,19,23) |
| InChIKey | VYSLKEKOQSOWQW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|