C23H23N3O2 — CID 161127367
3-[4-[(2R)-4-(4-aminooxan-4-yl)-2-cyano-4-oxobutyl]phenyl]benzonitrile (PubChem CID 161127367) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-[4-[(2R)-4-(4-aminooxan-4-yl)-2-cyano-4-oxobutyl]phenyl]benzonitrile.
| Compound Name | 3-[4-[(2R)-4-(4-aminooxan-4-yl)-2-cyano-4-oxobutyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 161127367 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-[4-[(2R)-4-(4-aminooxan-4-yl)-2-cyano-4-oxobutyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(C[C@@H](C#N)CC(=O)C3(N)CCOCC3)cc2)c1 |
| InChI | InChI=1S/C23H23N3O2/c24-15-18-2-1-3-21(13-18)20-6-4-17(5-7-20)12-19(16-25)14-22(27)23(26)8-10-28-11-9-23/h1-7,13,19H,8-12,14,26H2/t19-/m1/s1 |
| InChIKey | ULSTZHGLDIOIDN-LJQANCHMSA-N |
| XLogP | 3.37 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |