C17H16N2O — CID 72893749
2-[4-(3-cyanophenyl)phenyl]-N,N-dimethylacetamide (PubChem CID 72893749) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[4-(3-cyanophenyl)phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(3-cyanophenyl)phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 72893749 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-[4-(3-cyanophenyl)phenyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1ccc(-c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C17H16N2O/c1-19(2)17(20)11-13-6-8-15(9-7-13)16-5-3-4-14(10-16)12-18/h3-10H,11H2,1-2H3 |
| InChIKey | QYJKEUUGUSGBGS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |