C24H29N3O3 — CID 60557854
tert-butyl N-[[2-[3-(4-cyanophenyl)propanoylamino]phenyl]methyl]-N-ethylcarbamate (PubChem CID 60557854) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl N-[[2-[3-(4-cyanophenyl)propanoylamino]phenyl]methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[2-[3-(4-cyanophenyl)propanoylamino]phenyl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 60557854 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | tert-butyl N-[[2-[3-(4-cyanophenyl)propanoylamino]phenyl]methyl]-N-ethylcarbamate |
| SMILES | CCN(Cc1ccccc1NC(=O)CCc1ccc(C#N)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H29N3O3/c1-5-27(23(29)30-24(2,3)4)17-20-8-6-7-9-21(20)26-22(28)15-14-18-10-12-19(16-25)13-11-18/h6-13H,5,14-15,17H2,1-4H3,(H,26,28) |
| InChIKey | DVQNXPIBJLNDSJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |