C28H34N2O6 — CID 55700415
tert-butyl N-ethyl-N-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]phenyl]methyl]carbamate (PubChem CID 55700415) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 55700415 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | tert-butyl N-ethyl-N-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]phenyl]methyl]carbamate |
| SMILES | CCN(Cc1ccccc1NC(=O)CCc1c(C)c2ccc(OC)cc2oc1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34N2O6/c1-7-30(27(33)36-28(3,4)5)17-19-10-8-9-11-23(19)29-25(31)15-14-22-18(2)21-13-12-20(34-6)16-24(21)35-26(22)32/h8-13,16H,7,14-15,17H2,1-6H3,(H,29,31) |
| InChIKey | QLOHSBHPSYIIOE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|