C26H28N2O6 — CID 42924141
2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 42924141) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42924141 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3ccccc3C(=O)NCC3CCCO3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H28N2O6/c1-16-19-10-9-17(32-2)14-23(19)34-26(31)20(16)11-12-24(29)28-22-8-4-3-7-21(22)25(30)27-15-18-6-5-13-33-18/h3-4,7-10,14,18H,5-6,11-13,15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | KRIZJBRVFVETFS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|