C23H32N2O5 — CID 24642373
3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]propanamide (PubChem CID 24642373) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]propanamide.
| Compound Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 24642373 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)NCC3CN(CC(C)C)CCO3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H32N2O5/c1-15(2)13-25-9-10-29-18(14-25)12-24-22(26)8-7-20-16(3)19-6-5-17(28-4)11-21(19)30-23(20)27/h5-6,11,15,18H,7-10,12-14H2,1-4H3,(H,24,26) |
| InChIKey | XBUAQKRGNOKOLI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|