C21H28N2O3S — CID 55700260
tert-butyl N-ethyl-N-[[2-(3-thiophen-3-ylpropanoylamino)phenyl]methyl]carbamate (PubChem CID 55700260) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[[2-(3-thiophen-3-ylpropanoylamino)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[[2-(3-thiophen-3-ylpropanoylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 55700260 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl N-ethyl-N-[[2-(3-thiophen-3-ylpropanoylamino)phenyl]methyl]carbamate |
| SMILES | CCN(Cc1ccccc1NC(=O)CCc1ccsc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28N2O3S/c1-5-23(20(25)26-21(2,3)4)14-17-8-6-7-9-18(17)22-19(24)11-10-16-12-13-27-15-16/h6-9,12-13,15H,5,10-11,14H2,1-4H3,(H,22,24) |
| InChIKey | ZFSAXCRKAUQGIQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |