C19H23BrN2O3S — CID 60557887
tert-butyl N-[[2-[(5-bromothiophene-3-carbonyl)amino]phenyl]methyl]-N-ethylcarbamate (PubChem CID 60557887) has the molecular formula C19H23BrN2O3S and a molecular weight of 439.38 g/mol. Its IUPAC name is tert-butyl N-[[2-[(5-bromothiophene-3-carbonyl)amino]phenyl]methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[2-[(5-bromothiophene-3-carbonyl)amino]phenyl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 60557887 |
| Molecular Formula | C19H23BrN2O3S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | tert-butyl N-[[2-[(5-bromothiophene-3-carbonyl)amino]phenyl]methyl]-N-ethylcarbamate |
| SMILES | CCN(Cc1ccccc1NC(=O)c1csc(Br)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23BrN2O3S/c1-5-22(18(24)25-19(2,3)4)11-13-8-6-7-9-15(13)21-17(23)14-10-16(20)26-12-14/h6-10,12H,5,11H2,1-4H3,(H,21,23) |
| InChIKey | XNHYRGUHRFYARS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |