C24H29N3O4 — CID 60557768
tert-butyl N-ethyl-N-[[2-[(6-methoxy-1H-indole-2-carbonyl)amino]phenyl]methyl]carbamate (PubChem CID 60557768) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[[2-[(6-methoxy-1H-indole-2-carbonyl)amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[[2-[(6-methoxy-1H-indole-2-carbonyl)amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 60557768 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl N-ethyl-N-[[2-[(6-methoxy-1H-indole-2-carbonyl)amino]phenyl]methyl]carbamate |
| SMILES | CCN(Cc1ccccc1NC(=O)c1cc2ccc(OC)cc2[nH]1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H29N3O4/c1-6-27(23(29)31-24(2,3)4)15-17-9-7-8-10-19(17)26-22(28)21-13-16-11-12-18(30-5)14-20(16)25-21/h7-14,25H,6,15H2,1-5H3,(H,26,28) |
| InChIKey | IUYIYHVXKBOETD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |