C15H19N3O4 — CID 71885448
tert-butyl N-[(6-methoxy-1H-indole-2-carbonyl)amino]carbamate (PubChem CID 71885448) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is tert-butyl N-[(6-methoxy-1H-indole-2-carbonyl)amino]carbamate.
| Compound Name | tert-butyl N-[(6-methoxy-1H-indole-2-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 71885448 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl N-[(6-methoxy-1H-indole-2-carbonyl)amino]carbamate |
| SMILES | COc1ccc2cc(C(=O)NNC(=O)OC(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C15H19N3O4/c1-15(2,3)22-14(20)18-17-13(19)12-7-9-5-6-10(21-4)8-11(9)16-12/h5-8,16H,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | VFJSKQHEVSUMLT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|