C24H21N3O4 — CID 46445650
6-methoxy-N'-[2-(2-phenylphenoxy)acetyl]-1H-indole-2-carbohydrazide (PubChem CID 46445650) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 6-methoxy-N'-[2-(2-phenylphenoxy)acetyl]-1H-indole-2-carbohydrazide.
| Compound Name | 6-methoxy-N'-[2-(2-phenylphenoxy)acetyl]-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 46445650 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-methoxy-N'-[2-(2-phenylphenoxy)acetyl]-1H-indole-2-carbohydrazide |
| SMILES | COc1ccc2cc(C(=O)NNC(=O)COc3ccccc3-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C24H21N3O4/c1-30-18-12-11-17-13-21(25-20(17)14-18)24(29)27-26-23(28)15-31-22-10-6-5-9-19(22)16-7-3-2-4-8-16/h2-14,25H,15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | ADGNCYNBRWYFPW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|